C8H13F6NO2 — CID 102723293
N-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]-2-methoxyethanamine (PubChem CID 102723293) has the molecular formula C8H13F6NO2 and a molecular weight of 269.19 g/mol. Its IUPAC name is N-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]-2-methoxyethanamine.
| Compound Name | N-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 102723293 |
| Molecular Formula | C8H13F6NO2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | N-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethyl]-2-methoxyethanamine |
| SMILES | COCCNCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H13F6NO2/c1-16-4-2-15-3-5-17-6(7(9,10)11)8(12,13)14/h6,15H,2-5H2,1H3 |
| InChIKey | QJHKVWPVGXOLAA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|