C8H13F6NO3S — CID 102723330
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(2-methylsulfonylethyl)ethanamine (PubChem CID 102723330) has the molecular formula C8H13F6NO3S and a molecular weight of 317.25 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(2-methylsulfonylethyl)ethanamine.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(2-methylsulfonylethyl)ethanamine |
|---|---|
| PubChem CID | 102723330 |
| Molecular Formula | C8H13F6NO3S |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-N-(2-methylsulfonylethyl)ethanamine |
| SMILES | CS(=O)(=O)CCNCCOC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H13F6NO3S/c1-19(16,17)5-3-15-2-4-18-6(7(9,10)11)8(12,13)14/h6,15H,2-5H2,1H3 |
| InChIKey | DCASUVYULCUPBU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|