C5H10F2O2 — CID 82006687
1-(2,2-difluoroethoxy)propan-2-ol (PubChem CID 82006687) has the molecular formula C5H10F2O2 and a molecular weight of 140.13 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)propan-2-ol.
| Compound Name | 1-(2,2-difluoroethoxy)propan-2-ol |
|---|---|
| PubChem CID | 82006687 |
| Molecular Formula | C5H10F2O2 |
| Molecular Weight | 140.13 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 1-(2,2-difluoroethoxy)propan-2-ol |
| SMILES | CC(O)COCC(F)F |
| InChI | InChI=1S/C5H10F2O2/c1-4(8)2-9-3-5(6)7/h4-5,8H,2-3H2,1H3 |
| InChIKey | HMCGBCWSLRAKEL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.13 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |