C7H13F3O3 — CID 154623550
1-(2,2-difluoroethoxy)-3-(2-fluoroethoxy)propan-2-ol (PubChem CID 154623550) has the molecular formula C7H13F3O3 and a molecular weight of 202.17 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-3-(2-fluoroethoxy)propan-2-ol.
| Compound Name | 1-(2,2-difluoroethoxy)-3-(2-fluoroethoxy)propan-2-ol |
|---|---|
| PubChem CID | 154623550 |
| Molecular Formula | C7H13F3O3 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-3-(2-fluoroethoxy)propan-2-ol |
| SMILES | OC(COCCF)COCC(F)F |
| InChI | InChI=1S/C7H13F3O3/c8-1-2-12-3-6(11)4-13-5-7(9)10/h6-7,11H,1-5H2 |
| InChIKey | ZAUOVJYPHIOYBO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|