C3H7F2NO — CID 162615781
2,2-difluoroethoxymethanamine (PubChem CID 162615781) has the molecular formula C3H7F2NO and a molecular weight of 111.09 g/mol. Its IUPAC name is 2,2-difluoroethoxymethanamine.
| Compound Name | 2,2-difluoroethoxymethanamine |
|---|---|
| PubChem CID | 162615781 |
| Molecular Formula | C3H7F2NO |
| Molecular Weight | 111.09 g/mol |
| Exact Mass | 111.05 |
| IUPAC Name | 2,2-difluoroethoxymethanamine |
| SMILES | NCOCC(F)F |
| InChI | InChI=1S/C3H7F2NO/c4-3(5)1-7-2-6/h3H,1-2,6H2 |
| InChIKey | ZJDSWMBUXRXENC-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.09 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|