C6H11F2NO — CID 103075032
2-(2,2-difluoroethoxymethyl)prop-2-en-1-amine (PubChem CID 103075032) has the molecular formula C6H11F2NO and a molecular weight of 151.16 g/mol. Its IUPAC name is 2-(2,2-difluoroethoxymethyl)prop-2-en-1-amine.
| Compound Name | 2-(2,2-difluoroethoxymethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 103075032 |
| Molecular Formula | C6H11F2NO |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 2-(2,2-difluoroethoxymethyl)prop-2-en-1-amine |
| SMILES | C=C(CN)COCC(F)F |
| InChI | InChI=1S/C6H11F2NO/c1-5(2-9)3-10-4-6(7)8/h6H,1-4,9H2 |
| InChIKey | SVYVBUWMSHAEGH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|