C6H9ClF2O — CID 103066179
2-(chloromethyl)-3-(2,2-difluoroethoxy)prop-1-ene (PubChem CID 103066179) has the molecular formula C6H9ClF2O and a molecular weight of 170.59 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(2,2-difluoroethoxy)prop-1-ene.
| Compound Name | 2-(chloromethyl)-3-(2,2-difluoroethoxy)prop-1-ene |
|---|---|
| PubChem CID | 103066179 |
| Molecular Formula | C6H9ClF2O |
| Molecular Weight | 170.59 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 2-(chloromethyl)-3-(2,2-difluoroethoxy)prop-1-ene |
| SMILES | C=C(CCl)COCC(F)F |
| InChI | InChI=1S/C6H9ClF2O/c1-5(2-7)3-10-4-6(8)9/h6H,1-4H2 |
| InChIKey | AMYWPJLWUKJUSU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.59 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|