C17H20N2O9S2 — CID 57099376
(2R)-2-acetamido-3-[(2S)-2-[acetyl(benzoyl)amino]-3-sulfopropanoyl]sulfanylpropanoic acid (PubChem CID 57099376) has the molecular formula C17H20N2O9S2 and a molecular weight of 460.49 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(2S)-2-[acetyl(benzoyl)amino]-3-sulfopropanoyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[(2S)-2-[acetyl(benzoyl)amino]-3-sulfopropanoyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 57099376 |
| Molecular Formula | C17H20N2O9S2 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | (2R)-2-acetamido-3-[(2S)-2-[acetyl(benzoyl)amino]-3-sulfopropanoyl]sulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CSC(=O)[C@H](CS(=O)(=O)O)N(C(C)=O)C(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H20N2O9S2/c1-10(20)18-13(16(23)24)8-29-17(25)14(9-30(26,27)28)19(11(2)21)15(22)12-6-4-3-5-7-12/h3-7,13-14H,8-9H2,1-2H3,(H,18,20)(H,23,24)(H,26,27,28)/t13-,14-/m0/s1 |
| InChIKey | QKNOWJYYAGQPHP-KBPBESRZSA-N |
| XLogP | -0.22 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|