C13H17NO5S2 — CID 107768391
2-acetamido-3-(2-ethylsulfonylphenyl)sulfanylpropanoic acid (PubChem CID 107768391) has the molecular formula C13H17NO5S2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-acetamido-3-(2-ethylsulfonylphenyl)sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-(2-ethylsulfonylphenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 107768391 |
| Molecular Formula | C13H17NO5S2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 2-acetamido-3-(2-ethylsulfonylphenyl)sulfanylpropanoic acid |
| SMILES | CCS(=O)(=O)c1ccccc1SCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C13H17NO5S2/c1-3-21(18,19)12-7-5-4-6-11(12)20-8-10(13(16)17)14-9(2)15/h4-7,10H,3,8H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | HSJYYVDMEJFDPV-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |