C20H21NO4S — CID 88771284
3-[(2S)-2-benzamido-3-phenylpropanoyl]sulfanyl-2-methylpropanoic acid (PubChem CID 88771284) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is 3-[(2S)-2-benzamido-3-phenylpropanoyl]sulfanyl-2-methylpropanoic acid.
| Compound Name | 3-[(2S)-2-benzamido-3-phenylpropanoyl]sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 88771284 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 3-[(2S)-2-benzamido-3-phenylpropanoyl]sulfanyl-2-methylpropanoic acid |
| SMILES | CC(CSC(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H21NO4S/c1-14(19(23)24)13-26-20(25)17(12-15-8-4-2-5-9-15)21-18(22)16-10-6-3-7-11-16/h2-11,14,17H,12-13H2,1H3,(H,21,22)(H,23,24)/t14?,17-/m0/s1 |
| InChIKey | MEUQUUUUMAXUQA-JRZJBTRGSA-N |
| XLogP | 3.01 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|