C21H25NO3 — CID 58019158
(2S,4S)-2-benzamido-4-benzyl-5-methylhexanoic acid (PubChem CID 58019158) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is (2S,4S)-2-benzamido-4-benzyl-5-methylhexanoic acid.
| Compound Name | (2S,4S)-2-benzamido-4-benzyl-5-methylhexanoic acid |
|---|---|
| PubChem CID | 58019158 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | (2S,4S)-2-benzamido-4-benzyl-5-methylhexanoic acid |
| SMILES | CC(C)[C@@H](Cc1ccccc1)C[C@H](NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H25NO3/c1-15(2)18(13-16-9-5-3-6-10-16)14-19(21(24)25)22-20(23)17-11-7-4-8-12-17/h3-12,15,18-19H,13-14H2,1-2H3,(H,22,23)(H,24,25)/t18-,19-/m0/s1 |
| InChIKey | PUMCLBRQAUGDCJ-OALUTQOASA-N |
| XLogP | 3.77 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |