C26H39N7O7S — CID 126658485
tert-butyl N-[1-[4-[[(2S)-1-(benzenesulfonamido)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-1,3-oxazol-2-yl]-3-methylbutyl]carbamate (PubChem CID 126658485) has the molecular formula C26H39N7O7S and a molecular weight of 593.71 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[[(2S)-1-(benzenesulfonamido)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-1,3-oxazol-2-yl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[[(2S)-1-(benzenesulfonamido)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-1,3-oxazol-2-yl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 126658485 |
| Molecular Formula | C26H39N7O7S |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.26 |
| IUPAC Name | tert-butyl N-[1-[4-[[(2S)-1-(benzenesulfonamido)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-1,3-oxazol-2-yl]-3-methylbutyl]carbamate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)c1nc(C(=O)N[C@@H](CCCN=C(N)N)C(=O)NS(=O)(=O)c2ccccc2)co1 |
| InChI | InChI=1S/C26H39N7O7S/c1-16(2)14-19(32-25(36)40-26(3,4)5)23-31-20(15-39-23)21(34)30-18(12-9-13-29-24(27)28)22(35)33-41(37,38)17-10-7-6-8-11-17/h6-8,10-11,15-16,18-19H,9,12-14H2,1-5H3,(H,30,34)(H,32,36)(H,33,35)(H4,27,28,29)/t18-,19?/m0/s1 |
| InChIKey | HHFUDOODSXXCSP-OYKVQYDMSA-N |
| XLogP | 1.94 |
| TPSA | 221.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|