C19H33N5O5 — CID 138747383
tert-butyl N-[(1S)-1-[4-[4-(carbamoylamino)butylcarbamoyl]-1,3-oxazol-2-yl]-3-methylbutyl]carbamate (PubChem CID 138747383) has the molecular formula C19H33N5O5 and a molecular weight of 411.50 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[4-[4-(carbamoylamino)butylcarbamoyl]-1,3-oxazol-2-yl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[4-[4-(carbamoylamino)butylcarbamoyl]-1,3-oxazol-2-yl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 138747383 |
| Molecular Formula | C19H33N5O5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | tert-butyl N-[(1S)-1-[4-[4-(carbamoylamino)butylcarbamoyl]-1,3-oxazol-2-yl]-3-methylbutyl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)c1nc(C(=O)NCCCCNC(N)=O)co1 |
| InChI | InChI=1S/C19H33N5O5/c1-12(2)10-13(24-18(27)29-19(3,4)5)16-23-14(11-28-16)15(25)21-8-6-7-9-22-17(20)26/h11-13H,6-10H2,1-5H3,(H,21,25)(H,24,27)(H3,20,22,26)/t13-/m0/s1 |
| InChIKey | DWCQCYQRUCHGQH-ZDUSSCGKSA-N |
| XLogP | 2.46 |
| TPSA | 148.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|