C19H33N7O6 — CID 138747742
tert-butyl N-[(1S)-1-[4-[4-[[amino(nitramido)methylidene]amino]butylcarbamoyl]-1,3-oxazol-2-yl]-3-methylbutyl]carbamate (PubChem CID 138747742) has the molecular formula C19H33N7O6 and a molecular weight of 455.52 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[4-[4-[[amino(nitramido)methylidene]amino]butylcarbamoyl]-1,3-oxazol-2-yl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[4-[4-[[amino(nitramido)methylidene]amino]butylcarbamoyl]-1,3-oxazol-2-yl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 138747742 |
| Molecular Formula | C19H33N7O6 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | tert-butyl N-[(1S)-1-[4-[4-[[amino(nitramido)methylidene]amino]butylcarbamoyl]-1,3-oxazol-2-yl]-3-methylbutyl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)c1nc(C(=O)NCCCC/N=C(\N)N[N+](=O)[O-])co1 |
| InChI | InChI=1S/C19H33N7O6/c1-12(2)10-13(24-18(28)32-19(3,4)5)16-23-14(11-31-16)15(27)21-8-6-7-9-22-17(20)25-26(29)30/h11-13H,6-10H2,1-5H3,(H,21,27)(H,24,28)(H3,20,22,25)/t13-/m0/s1 |
| InChIKey | DEBUCJKJOHMLTM-ZDUSSCGKSA-N |
| XLogP | 1.89 |
| TPSA | 187.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|