C16H27N7O6 — CID 3541780
methyl 5-[[amino(nitramido)methylidene]amino]-2-[[2-(1-aminopentyl)-1,3-oxazole-4-carbonyl]amino]pentanoate (PubChem CID 3541780) has the molecular formula C16H27N7O6 and a molecular weight of 413.44 g/mol. Its IUPAC name is methyl 5-[[amino(nitramido)methylidene]amino]-2-[[2-(1-aminopentyl)-1,3-oxazole-4-carbonyl]amino]pentanoate.
| Compound Name | methyl 5-[[amino(nitramido)methylidene]amino]-2-[[2-(1-aminopentyl)-1,3-oxazole-4-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 3541780 |
| Molecular Formula | C16H27N7O6 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | methyl 5-[[amino(nitramido)methylidene]amino]-2-[[2-(1-aminopentyl)-1,3-oxazole-4-carbonyl]amino]pentanoate |
| SMILES | CCCCC(N)c1nc(C(=O)NC(CCC/N=C(\N)N[N+](=O)[O-])C(=O)OC)co1 |
| InChI | InChI=1S/C16H27N7O6/c1-3-4-6-10(17)14-21-12(9-29-14)13(24)20-11(15(25)28-2)7-5-8-19-16(18)22-23(26)27/h9-11H,3-8,17H2,1-2H3,(H,20,24)(H3,18,19,22) |
| InChIKey | NNIDVFLCVSAJIZ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 201.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|