C17H23N3O3 — CID 3731660
2-(1-aminopentyl)-N-(2-phenoxyethyl)-1,3-oxazole-4-carboxamide (PubChem CID 3731660) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(1-aminopentyl)-N-(2-phenoxyethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-aminopentyl)-N-(2-phenoxyethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3731660 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-(1-aminopentyl)-N-(2-phenoxyethyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCCCC(N)c1nc(C(=O)NCCOc2ccccc2)co1 |
| InChI | InChI=1S/C17H23N3O3/c1-2-3-9-14(18)17-20-15(12-23-17)16(21)19-10-11-22-13-7-5-4-6-8-13/h4-8,12,14H,2-3,9-11,18H2,1H3,(H,19,21) |
| InChIKey | QPYPHAWWQXLYKX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|