C18H24N4O4 — CID 3833643
benzyl N-[3-[[2-(1-aminopropyl)-1,3-oxazole-4-carbonyl]amino]propyl]carbamate (PubChem CID 3833643) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is benzyl N-[3-[[2-(1-aminopropyl)-1,3-oxazole-4-carbonyl]amino]propyl]carbamate.
| Compound Name | benzyl N-[3-[[2-(1-aminopropyl)-1,3-oxazole-4-carbonyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 3833643 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | benzyl N-[3-[[2-(1-aminopropyl)-1,3-oxazole-4-carbonyl]amino]propyl]carbamate |
| SMILES | CCC(N)c1nc(C(=O)NCCCNC(=O)OCc2ccccc2)co1 |
| InChI | InChI=1S/C18H24N4O4/c1-2-14(19)17-22-15(12-25-17)16(23)20-9-6-10-21-18(24)26-11-13-7-4-3-5-8-13/h3-5,7-8,12,14H,2,6,9-11,19H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | XQWSXKLZIAFHCH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|