C15H19N3O2S — CID 3270325
2-(1-amino-2-phenylethyl)-N-(2-methylsulfanylethyl)-1,3-oxazole-4-carboxamide (PubChem CID 3270325) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-(1-amino-2-phenylethyl)-N-(2-methylsulfanylethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-amino-2-phenylethyl)-N-(2-methylsulfanylethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3270325 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(1-amino-2-phenylethyl)-N-(2-methylsulfanylethyl)-1,3-oxazole-4-carboxamide |
| SMILES | CSCCNC(=O)c1coc(C(N)Cc2ccccc2)n1 |
| InChI | InChI=1S/C15H19N3O2S/c1-21-8-7-17-14(19)13-10-20-15(18-13)12(16)9-11-5-3-2-4-6-11/h2-6,10,12H,7-9,16H2,1H3,(H,17,19) |
| InChIKey | IKYCOXGDVIDUKS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|