C15H19N3O3S — CID 3704491
2-(1-amino-2-hydroxyethyl)-N-(2-benzylsulfanylethyl)-1,3-oxazole-4-carboxamide (PubChem CID 3704491) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 2-(1-amino-2-hydroxyethyl)-N-(2-benzylsulfanylethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-amino-2-hydroxyethyl)-N-(2-benzylsulfanylethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3704491 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-(1-amino-2-hydroxyethyl)-N-(2-benzylsulfanylethyl)-1,3-oxazole-4-carboxamide |
| SMILES | NC(CO)c1nc(C(=O)NCCSCc2ccccc2)co1 |
| InChI | InChI=1S/C15H19N3O3S/c16-12(8-19)15-18-13(9-21-15)14(20)17-6-7-22-10-11-4-2-1-3-5-11/h1-5,9,12,19H,6-8,10,16H2,(H,17,20) |
| InChIKey | FMBLTHVMAXKQMK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|