C12H13N3O2 — CID 110852301
2-amino-N-(2-phenylethyl)-1,3-oxazole-4-carboxamide (PubChem CID 110852301) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is 2-amino-N-(2-phenylethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-amino-N-(2-phenylethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 110852301 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 2-amino-N-(2-phenylethyl)-1,3-oxazole-4-carboxamide |
| SMILES | Nc1nc(C(=O)NCCc2ccccc2)co1 |
| InChI | InChI=1S/C12H13N3O2/c13-12-15-10(8-17-12)11(16)14-7-6-9-4-2-1-3-5-9/h1-5,8H,6-7H2,(H2,13,15)(H,14,16) |
| InChIKey | DAENPZOOGXWBMG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |