C22H25N3O2 — CID 3798183
2-(1-amino-2-phenylethyl)-N-(4-phenylbutyl)-1,3-oxazole-4-carboxamide (PubChem CID 3798183) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-(1-amino-2-phenylethyl)-N-(4-phenylbutyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-amino-2-phenylethyl)-N-(4-phenylbutyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3798183 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 2-(1-amino-2-phenylethyl)-N-(4-phenylbutyl)-1,3-oxazole-4-carboxamide |
| SMILES | NC(Cc1ccccc1)c1nc(C(=O)NCCCCc2ccccc2)co1 |
| InChI | InChI=1S/C22H25N3O2/c23-19(15-18-12-5-2-6-13-18)22-25-20(16-27-22)21(26)24-14-8-7-11-17-9-3-1-4-10-17/h1-6,9-10,12-13,16,19H,7-8,11,14-15,23H2,(H,24,26) |
| InChIKey | IKGBLWUYZTZNQP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|