C23H36N4O3 — CID 3833731
2-[1-amino-2-(4-hydroxyphenyl)ethyl]-N-[3-(dibutylamino)propyl]-1,3-oxazole-4-carboxamide (PubChem CID 3833731) has the molecular formula C23H36N4O3 and a molecular weight of 416.57 g/mol. Its IUPAC name is 2-[1-amino-2-(4-hydroxyphenyl)ethyl]-N-[3-(dibutylamino)propyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[1-amino-2-(4-hydroxyphenyl)ethyl]-N-[3-(dibutylamino)propyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3833731 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 2-[1-amino-2-(4-hydroxyphenyl)ethyl]-N-[3-(dibutylamino)propyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCCN(CCCC)CCCNC(=O)c1coc(C(N)Cc2ccc(O)cc2)n1 |
| InChI | InChI=1S/C23H36N4O3/c1-3-5-13-27(14-6-4-2)15-7-12-25-22(29)21-17-30-23(26-21)20(24)16-18-8-10-19(28)11-9-18/h8-11,17,20,28H,3-7,12-16,24H2,1-2H3,(H,25,29) |
| InChIKey | RBEXYPFLTMOOCH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|