C33H36N4O7 — CID 3689358
benzyl 2-[[2-[1-amino-2-(4-hydroxyphenyl)ethyl]-1,3-oxazole-4-carbonyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 3689358) has the molecular formula C33H36N4O7 and a molecular weight of 600.67 g/mol. Its IUPAC name is benzyl 2-[[2-[1-amino-2-(4-hydroxyphenyl)ethyl]-1,3-oxazole-4-carbonyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | benzyl 2-[[2-[1-amino-2-(4-hydroxyphenyl)ethyl]-1,3-oxazole-4-carbonyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 3689358 |
| Molecular Formula | C33H36N4O7 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | benzyl 2-[[2-[1-amino-2-(4-hydroxyphenyl)ethyl]-1,3-oxazole-4-carbonyl]amino]-6-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | NC(Cc1ccc(O)cc1)c1nc(C(=O)NC(CCCCNC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)co1 |
| InChI | InChI=1S/C33H36N4O7/c34-27(19-23-14-16-26(38)17-15-23)31-37-29(22-42-31)30(39)36-28(32(40)43-20-24-9-3-1-4-10-24)13-7-8-18-35-33(41)44-21-25-11-5-2-6-12-25/h1-6,9-12,14-17,22,27-28,38H,7-8,13,18-21,34H2,(H,35,41)(H,36,39) |
| InChIKey | FTPVRVBQWSAFNY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 166.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|