C19H26N4O4 — CID 3850448
benzyl N-[3-[[2-(1-amino-2-methylpropyl)-1,3-oxazole-4-carbonyl]amino]propyl]carbamate (PubChem CID 3850448) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is benzyl N-[3-[[2-(1-amino-2-methylpropyl)-1,3-oxazole-4-carbonyl]amino]propyl]carbamate.
| Compound Name | benzyl N-[3-[[2-(1-amino-2-methylpropyl)-1,3-oxazole-4-carbonyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 3850448 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | benzyl N-[3-[[2-(1-amino-2-methylpropyl)-1,3-oxazole-4-carbonyl]amino]propyl]carbamate |
| SMILES | CC(C)C(N)c1nc(C(=O)NCCCNC(=O)OCc2ccccc2)co1 |
| InChI | InChI=1S/C19H26N4O4/c1-13(2)16(20)18-23-15(12-26-18)17(24)21-9-6-10-22-19(25)27-11-14-7-4-3-5-8-14/h3-5,7-8,12-13,16H,6,9-11,20H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | SWFLGUNNGVOIJK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 119.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|