C16H22N4O2 — CID 3796337
2-(1-aminopentyl)-N-[(4-aminophenyl)methyl]-1,3-oxazole-4-carboxamide (PubChem CID 3796337) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-(1-aminopentyl)-N-[(4-aminophenyl)methyl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-aminopentyl)-N-[(4-aminophenyl)methyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3796337 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 2-(1-aminopentyl)-N-[(4-aminophenyl)methyl]-1,3-oxazole-4-carboxamide |
| SMILES | CCCCC(N)c1nc(C(=O)NCc2ccc(N)cc2)co1 |
| InChI | InChI=1S/C16H22N4O2/c1-2-3-4-13(18)16-20-14(10-22-16)15(21)19-9-11-5-7-12(17)8-6-11/h5-8,10,13H,2-4,9,17-18H2,1H3,(H,19,21) |
| InChIKey | NGIVVFQCDCGJRL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|