C15H21N3O2 — CID 43470343
1-[3-(2-phenoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine (PubChem CID 43470343) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 1-[3-(2-phenoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine.
| Compound Name | 1-[3-(2-phenoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine |
|---|---|
| PubChem CID | 43470343 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 1-[3-(2-phenoxyethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine |
| SMILES | CCCCC(N)c1nc(CCOc2ccccc2)no1 |
| InChI | InChI=1S/C15H21N3O2/c1-2-3-9-13(16)15-17-14(18-20-15)10-11-19-12-7-5-4-6-8-12/h4-8,13H,2-3,9-11,16H2,1H3 |
| InChIKey | NJHOUZYKDZPPQR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |