C16H28N4O3 — CID 5160527
2-(1-aminopentyl)-N-(3-morpholin-4-ylpropyl)-1,3-oxazole-4-carboxamide (PubChem CID 5160527) has the molecular formula C16H28N4O3 and a molecular weight of 324.43 g/mol. Its IUPAC name is 2-(1-aminopentyl)-N-(3-morpholin-4-ylpropyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-(1-aminopentyl)-N-(3-morpholin-4-ylpropyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 5160527 |
| Molecular Formula | C16H28N4O3 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | 2-(1-aminopentyl)-N-(3-morpholin-4-ylpropyl)-1,3-oxazole-4-carboxamide |
| SMILES | CCCCC(N)c1nc(C(=O)NCCCN2CCOCC2)co1 |
| InChI | InChI=1S/C16H28N4O3/c1-2-3-5-13(17)16-19-14(12-23-16)15(21)18-6-4-7-20-8-10-22-11-9-20/h12-13H,2-11,17H2,1H3,(H,18,21) |
| InChIKey | CVWPUWNFSWXXQT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|