C24H35N5O7 — CID 71614099
methyl (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[4-[(2E)-2,6-dimethylhepta-2,5-dienoxy]-3-methoxybenzoyl]amino]pentanoate (PubChem CID 71614099) has the molecular formula C24H35N5O7 and a molecular weight of 505.57 g/mol. Its IUPAC name is methyl (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[4-[(2E)-2,6-dimethylhepta-2,5-dienoxy]-3-methoxybenzoyl]amino]pentanoate.
| Compound Name | methyl (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[4-[(2E)-2,6-dimethylhepta-2,5-dienoxy]-3-methoxybenzoyl]amino]pentanoate |
|---|---|
| PubChem CID | 71614099 |
| Molecular Formula | C24H35N5O7 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | methyl (2S)-5-[[amino(nitramido)methylidene]amino]-2-[[4-[(2E)-2,6-dimethylhepta-2,5-dienoxy]-3-methoxybenzoyl]amino]pentanoate |
| SMILES | COC(=O)[C@H](CCC/N=C(\N)N[N+](=O)[O-])NC(=O)c1ccc(OC/C(C)=C/CC=C(C)C)c(OC)c1 |
| InChI | InChI=1S/C24H35N5O7/c1-16(2)8-6-9-17(3)15-36-20-12-11-18(14-21(20)34-4)22(30)27-19(23(31)35-5)10-7-13-26-24(25)28-29(32)33/h8-9,11-12,14,19H,6-7,10,13,15H2,1-5H3,(H,27,30)(H3,25,26,28)/b17-9+/t19-/m0/s1 |
| InChIKey | HKYISYOJLXDOFM-OJEAVSNDSA-N |
| XLogP | 2.52 |
| TPSA | 167.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|