C11H15N5O4S — CID 174506426
N-[5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]thiophene-3-carboxamide (PubChem CID 174506426) has the molecular formula C11H15N5O4S and a molecular weight of 313.34 g/mol. Its IUPAC name is N-[5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]thiophene-3-carboxamide.
| Compound Name | N-[5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 174506426 |
| Molecular Formula | C11H15N5O4S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-[5-[[amino(nitramido)methylidene]amino]-1-oxopentan-2-yl]thiophene-3-carboxamide |
| SMILES | N/C(=N\CCCC(C=O)NC(=O)c1ccsc1)N[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N5O4S/c12-11(15-16(19)20)13-4-1-2-9(6-17)14-10(18)8-3-5-21-7-8/h3,5-7,9H,1-2,4H2,(H,14,18)(H3,12,13,15) |
| InChIKey | SBQMWZPZDACUAN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|