C26H38N6O6 — CID 123287985
5-(diaminomethylideneamino)-2-[[2-[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-5-phenyl-1,3-oxazole-4-carbonyl]amino]pentanoic acid (PubChem CID 123287985) has the molecular formula C26H38N6O6 and a molecular weight of 530.63 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[2-[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-5-phenyl-1,3-oxazole-4-carbonyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[2-[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-5-phenyl-1,3-oxazole-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 123287985 |
| Molecular Formula | C26H38N6O6 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.29 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[2-[3-methyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]butyl]-5-phenyl-1,3-oxazole-4-carbonyl]amino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)c1nc(C(=O)NC(CCCN=C(N)N)C(=O)O)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C26H38N6O6/c1-15(2)14-18(31-25(36)38-26(3,4)5)22-32-19(20(37-22)16-10-7-6-8-11-16)21(33)30-17(23(34)35)12-9-13-29-24(27)28/h6-8,10-11,15,17-18H,9,12-14H2,1-5H3,(H,30,33)(H,31,36)(H,34,35)(H4,27,28,29) |
| InChIKey | XHORDOWXAOXTFT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 195.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|