C25H33N7O6 — CID 71566651
(2S)-5-(diaminomethylideneamino)-2-[[2-[(1S)-2-(1H-indol-3-yl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid (PubChem CID 71566651) has the molecular formula C25H33N7O6 and a molecular weight of 527.58 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-[(1S)-2-(1H-indol-3-yl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[(1S)-2-(1H-indol-3-yl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 71566651 |
| Molecular Formula | C25H33N7O6 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[(1S)-2-(1H-indol-3-yl)-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1c[nH]c2ccccc12)c1nc(C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)co1 |
| InChI | InChI=1S/C25H33N7O6/c1-25(2,3)38-24(36)32-18(11-14-12-29-16-8-5-4-7-15(14)16)21-31-19(13-37-21)20(33)30-17(22(34)35)9-6-10-28-23(26)27/h4-5,7-8,12-13,17-18,29H,6,9-11H2,1-3H3,(H,30,33)(H,32,36)(H,34,35)(H4,26,27,28)/t17-,18-/m0/s1 |
| InChIKey | WYFXGBCRJAMZPG-ROUUACIJSA-N |
| XLogP | 2.20 |
| TPSA | 210.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|