C21H28N4O3S — CID 6577498
tert-butyl N-[(1R)-1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)-2-(1H-indol-3-yl)ethyl]carbamate (PubChem CID 6577498) has the molecular formula C21H28N4O3S and a molecular weight of 416.55 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)-2-(1H-indol-3-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)-2-(1H-indol-3-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 6577498 |
| Molecular Formula | C21H28N4O3S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | tert-butyl N-[(1R)-1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)-2-(1H-indol-3-yl)ethyl]carbamate |
| SMILES | CCCCSc1nnc([C@@H](Cc2c[nH]c3ccccc23)NC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C21H28N4O3S/c1-5-6-11-29-20-25-24-18(27-20)17(23-19(26)28-21(2,3)4)12-14-13-22-16-10-8-7-9-15(14)16/h7-10,13,17,22H,5-6,11-12H2,1-4H3,(H,23,26)/t17-/m1/s1 |
| InChIKey | CGOVICVGULLSKD-QGZVFWFLSA-N |
| XLogP | 5.25 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|