C16H21ClN4OS — CID 44661746
[(1S)-1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)-2-(1H-indol-3-yl)ethyl]azanium chloride (PubChem CID 44661746) has the molecular formula C16H21ClN4OS and a molecular weight of 352.89 g/mol. Its IUPAC name is [(1S)-1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)-2-(1H-indol-3-yl)ethyl]azanium chloride.
| Compound Name | [(1S)-1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)-2-(1H-indol-3-yl)ethyl]azanium chloride |
|---|---|
| PubChem CID | 44661746 |
| Molecular Formula | C16H21ClN4OS |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | [(1S)-1-(5-butylsulfanyl-1,3,4-oxadiazol-2-yl)-2-(1H-indol-3-yl)ethyl]azanium chloride |
| SMILES | CCCCSc1nnc([C@@H]([NH3+])Cc2c[nH]c3ccccc23)o1.[Cl-] |
| InChI | InChI=1S/C16H20N4OS.ClH/c1-2-3-8-22-16-20-19-15(21-16)13(17)9-11-10-18-14-7-5-4-6-12(11)14;/h4-7,10,13,18H,2-3,8-9,17H2,1H3;1H/t13-;/m0./s1 |
| InChIKey | MRXCARQHXVPZIN-ZOWNYOTGSA-N |
| XLogP | -0.03 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|