C16H18ClN4OS- — CID 53314694
(1S)-2-(1H-indol-3-yl)-1-[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]ethanamine chloride (PubChem CID 53314694) has the molecular formula C16H18ClN4OS- and a molecular weight of 349.87 g/mol. Its IUPAC name is (1S)-2-(1H-indol-3-yl)-1-[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]ethanamine chloride.
| Compound Name | (1S)-2-(1H-indol-3-yl)-1-[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]ethanamine chloride |
|---|---|
| PubChem CID | 53314694 |
| Molecular Formula | C16H18ClN4OS- |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (1S)-2-(1H-indol-3-yl)-1-[5-(2-methylprop-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]ethanamine chloride |
| SMILES | C=C(C)CSc1nnc([C@@H](N)Cc2c[nH]c3ccccc23)o1.[Cl-] |
| InChI | InChI=1S/C16H18N4OS.ClH/c1-10(2)9-22-16-20-19-15(21-16)13(17)7-11-8-18-14-6-4-3-5-12(11)14;/h3-6,8,13,18H,1,7,9,17H2,2H3;1H/p-1/t13-;/m0./s1 |
| InChIKey | PKOCGLVDLCWWAU-ZOWNYOTGSA-M |
| XLogP | 0.47 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|