C17H21ClN4OS — CID 6603232
(1S)-2-(1H-indol-3-yl)-1-[5-(3-methylbut-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride (PubChem CID 6603232) has the molecular formula C17H21ClN4OS and a molecular weight of 364.90 g/mol. Its IUPAC name is (1S)-2-(1H-indol-3-yl)-1-[5-(3-methylbut-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride.
| Compound Name | (1S)-2-(1H-indol-3-yl)-1-[5-(3-methylbut-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 6603232 |
| Molecular Formula | C17H21ClN4OS |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (1S)-2-(1H-indol-3-yl)-1-[5-(3-methylbut-2-enylsulfanyl)-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride |
| SMILES | CC(C)=CCSc1nnc([C@@H](N)Cc2c[nH]c3ccccc23)o1.Cl |
| InChI | InChI=1S/C17H20N4OS.ClH/c1-11(2)7-8-23-17-21-20-16(22-17)14(18)9-12-10-19-15-6-4-3-5-13(12)15;/h3-7,10,14,19H,8-9,18H2,1-2H3;1H/t14-;/m0./s1 |
| InChIKey | DCQGYGMCCRYWHP-UQKRIMTDSA-N |
| XLogP | 4.27 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|