C24H35N7O5 — CID 71565508
(2S)-5-(diaminomethylideneamino)-2-[[2-[(1S,2S)-1-[[4-(dimethylamino)benzoyl]amino]-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid (PubChem CID 71565508) has the molecular formula C24H35N7O5 and a molecular weight of 501.59 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-[(1S,2S)-1-[[4-(dimethylamino)benzoyl]amino]-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[(1S,2S)-1-[[4-(dimethylamino)benzoyl]amino]-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 71565508 |
| Molecular Formula | C24H35N7O5 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[(1S,2S)-1-[[4-(dimethylamino)benzoyl]amino]-2-methylbutyl]-1,3-oxazole-4-carbonyl]amino]pentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccc(N(C)C)cc1)c1nc(C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)co1 |
| InChI | InChI=1S/C24H35N7O5/c1-5-14(2)19(30-20(32)15-8-10-16(11-9-15)31(3)4)22-29-18(13-36-22)21(33)28-17(23(34)35)7-6-12-27-24(25)26/h8-11,13-14,17,19H,5-7,12H2,1-4H3,(H,28,33)(H,30,32)(H,34,35)(H4,25,26,27)/t14-,17-,19-/m0/s1 |
| InChIKey | NVDLCGIHQBXLOP-FNHZYXHNSA-N |
| XLogP | 1.49 |
| TPSA | 189.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|