C17H28N6O4 — CID 3836348
ethyl 5-(diaminomethylideneamino)-2-[(2-piperidin-3-yl-1,3-oxazole-4-carbonyl)amino]pentanoate (PubChem CID 3836348) has the molecular formula C17H28N6O4 and a molecular weight of 380.45 g/mol. Its IUPAC name is ethyl 5-(diaminomethylideneamino)-2-[(2-piperidin-3-yl-1,3-oxazole-4-carbonyl)amino]pentanoate.
| Compound Name | ethyl 5-(diaminomethylideneamino)-2-[(2-piperidin-3-yl-1,3-oxazole-4-carbonyl)amino]pentanoate |
|---|---|
| PubChem CID | 3836348 |
| Molecular Formula | C17H28N6O4 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | ethyl 5-(diaminomethylideneamino)-2-[(2-piperidin-3-yl-1,3-oxazole-4-carbonyl)amino]pentanoate |
| SMILES | CCOC(=O)C(CCCN=C(N)N)NC(=O)c1coc(C2CCCNC2)n1 |
| InChI | InChI=1S/C17H28N6O4/c1-2-26-16(25)12(6-4-8-21-17(18)19)22-14(24)13-10-27-15(23-13)11-5-3-7-20-9-11/h10-12,20H,2-9H2,1H3,(H,22,24)(H4,18,19,21) |
| InChIKey | BIKSVXLXDVFBKD-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 157.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|