About N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide
N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide (PubChem CID 3785755) has the molecular formula C16H27N3O2
and a molecular weight of 293.41 g/mol. Its IUPAC name is N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide |
| PubChem CID | 3785755 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCC(C)NC(=O)c1coc(C2CCNCC2)n1 |
| InChI | InChI=1S/C16H27N3O2/c1-3-4-5-6-12(2)18-15(20)14-11-21-16(19-14)13-7-9-17-10-8-13/h11-13,17H,3-10H2,1-2H3,(H,18,20) |
| InChIKey | YFGKWJABHGYUIM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide?
The IUPAC name of N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide (CID 3785755) is N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide is CCCCCC(C)NC(=O)c1coc(C2CCNCC2)n1.
What is the InChIKey of N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide?
The InChIKey is YFGKWJABHGYUIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O2/c1-3-4-5-6-12(2)18-15(20)14-11-21-16(19-14)13-7-9-17-10-8-13/h11-13,17H,3-10H2,1-2H3,(H,18,20).
What are the key properties of N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide?
N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide has a molecular weight of 293.41 g/mol, XLogP of 2.84, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptan-2-yl-2-piperidin-4-yl-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 3785755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).