C17H21N3O2 — CID 3868751
N-(1-phenylethyl)-2-piperidin-4-yl-1,3-oxazole-4-carboxamide (PubChem CID 3868751) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-(1-phenylethyl)-2-piperidin-4-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(1-phenylethyl)-2-piperidin-4-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3868751 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | N-(1-phenylethyl)-2-piperidin-4-yl-1,3-oxazole-4-carboxamide |
| SMILES | CC(NC(=O)c1coc(C2CCNCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C17H21N3O2/c1-12(13-5-3-2-4-6-13)19-16(21)15-11-22-17(20-15)14-7-9-18-10-8-14/h2-6,11-12,14,18H,7-10H2,1H3,(H,19,21) |
| InChIKey | CVZPSVQEMXHBFH-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |