C16H19N3O3 — CID 3857041
N-(4-methoxyphenyl)-2-piperidin-4-yl-1,3-oxazole-4-carboxamide (PubChem CID 3857041) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-piperidin-4-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-2-piperidin-4-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 3857041 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-(4-methoxyphenyl)-2-piperidin-4-yl-1,3-oxazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2coc(C3CCNCC3)n2)cc1 |
| InChI | InChI=1S/C16H19N3O3/c1-21-13-4-2-12(3-5-13)18-15(20)14-10-22-16(19-14)11-6-8-17-9-7-11/h2-5,10-11,17H,6-9H2,1H3,(H,18,20) |
| InChIKey | BVZONAFFCXIPAM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |