C18H25N3O5 — CID 175570678
diethyl (2S)-2-[(5-amino-6-cyclopropylpyridine-2-carbonyl)amino]pentanedioate (PubChem CID 175570678) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is diethyl (2S)-2-[(5-amino-6-cyclopropylpyridine-2-carbonyl)amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[(5-amino-6-cyclopropylpyridine-2-carbonyl)amino]pentanedioate |
|---|---|
| PubChem CID | 175570678 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | diethyl (2S)-2-[(5-amino-6-cyclopropylpyridine-2-carbonyl)amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccc(N)c(C2CC2)n1)C(=O)OCC |
| InChI | InChI=1S/C18H25N3O5/c1-3-25-15(22)10-9-14(18(24)26-4-2)21-17(23)13-8-7-12(19)16(20-13)11-5-6-11/h7-8,11,14H,3-6,9-10,19H2,1-2H3,(H,21,23)/t14-/m0/s1 |
| InChIKey | UGGTVDICDCVXLE-AWEZNQCLSA-N |
| XLogP | 1.55 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |