About 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene
1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene (PubChem CID 70261829) has the molecular formula C18H20O3
and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene.
Molecular Properties
| Compound Name | 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene |
| PubChem CID | 70261829 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene |
| SMILES | C=COC=C.CC=CC(=O)c1ccccc1C(=O)C=CC |
| InChI | InChI=1S/C14H14O2.C4H6O/c1-3-7-13(15)11-9-5-6-10-12(11)14(16)8-4-2;1-3-5-4-2/h3-10H,1-2H3;3-4H,1-2H2 |
| InChIKey | VTBKJHSUQSZOFM-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene?
The IUPAC name of 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene (CID 70261829) is 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene.
What is the SMILES notation for 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene?
The canonical SMILES for 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene is C=COC=C.CC=CC(=O)c1ccccc1C(=O)C=CC.
What is the InChIKey of 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene?
The InChIKey is VTBKJHSUQSZOFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2.C4H6O/c1-3-7-13(15)11-9-5-6-10-12(11)14(16)8-4-2;1-3-5-4-2/h3-10H,1-2H3;3-4H,1-2H2.
What are the key properties of 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene?
1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene has a molecular weight of 284.36 g/mol, XLogP of 4.49, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-but-2-enoylphenyl)but-2-en-1-one;ethenoxyethene is sourced from PubChem (CID 70261829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).