C23H18Br2O5 — CID 155672553
(E)-3-(2,3-dibromo-4,5-dihydroxyphenyl)-1-[4-(4-ethoxyphenoxy)phenyl]prop-2-en-1-one (PubChem CID 155672553) has the molecular formula C23H18Br2O5 and a molecular weight of 534.20 g/mol. Its IUPAC name is (E)-3-(2,3-dibromo-4,5-dihydroxyphenyl)-1-[4-(4-ethoxyphenoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dibromo-4,5-dihydroxyphenyl)-1-[4-(4-ethoxyphenoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155672553 |
| Molecular Formula | C23H18Br2O5 |
| Molecular Weight | 534.20 g/mol |
| Exact Mass | 531.95 |
| IUPAC Name | (E)-3-(2,3-dibromo-4,5-dihydroxyphenyl)-1-[4-(4-ethoxyphenoxy)phenyl]prop-2-en-1-one |
| SMILES | CCOc1ccc(Oc2ccc(C(=O)/C=C/c3cc(O)c(O)c(Br)c3Br)cc2)cc1 |
| InChI | InChI=1S/C23H18Br2O5/c1-2-29-16-8-10-18(11-9-16)30-17-6-3-14(4-7-17)19(26)12-5-15-13-20(27)23(28)22(25)21(15)24/h3-13,27-28H,2H2,1H3/b12-5+ |
| InChIKey | CEFMFFITHQUXKR-LFYBBSHMSA-N |
| XLogP | 6.71 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.20 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|