About 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide
2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide (PubChem CID 29356514) has the molecular formula C22H24BrNO5
and a molecular weight of 462.34 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide |
| PubChem CID | 29356514 |
| Molecular Formula | C22H24BrNO5 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1ccc(C(=O)/C=C/c2cc(O)c(OC)cc2Br)cc1 |
| InChI | InChI=1S/C22H24BrNO5/c1-4-24(5-2)22(27)14-29-17-9-6-15(7-10-17)19(25)11-8-16-12-20(26)21(28-3)13-18(16)23/h6-13,26H,4-5,14H2,1-3H3/b11-8+ |
| InChIKey | BHOUQUKFDBJLET-DHZHZOJOSA-N |
| XLogP | 4.31 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide?
The IUPAC name of 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide (CID 29356514) is 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide.
What is the SMILES notation for 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide?
The canonical SMILES for 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide is CCN(CC)C(=O)COc1ccc(C(=O)/C=C/c2cc(O)c(OC)cc2Br)cc1.
What is the InChIKey of 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide?
The InChIKey is BHOUQUKFDBJLET-DHZHZOJOSA-N. The full InChI is InChI=1S/C22H24BrNO5/c1-4-24(5-2)22(27)14-29-17-9-6-15(7-10-17)19(25)11-8-16-12-20(26)21(28-3)13-18(16)23/h6-13,26H,4-5,14H2,1-3H3/b11-8+.
What are the key properties of 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide?
2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide has a molecular weight of 462.34 g/mol, XLogP of 4.31, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(E)-3-(2-bromo-5-hydroxy-4-methoxyphenyl)prop-2-enoyl]phenoxy]-N,N-diethylacetamide is sourced from PubChem (CID 29356514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).