C18H15BrO6 — CID 54580826
2-[4-[(E)-3-(5-bromo-4-hydroxy-2-methoxyphenyl)prop-2-enoyl]phenoxy]acetic acid (PubChem CID 54580826) has the molecular formula C18H15BrO6 and a molecular weight of 407.22 g/mol. Its IUPAC name is 2-[4-[(E)-3-(5-bromo-4-hydroxy-2-methoxyphenyl)prop-2-enoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-3-(5-bromo-4-hydroxy-2-methoxyphenyl)prop-2-enoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 54580826 |
| Molecular Formula | C18H15BrO6 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 2-[4-[(E)-3-(5-bromo-4-hydroxy-2-methoxyphenyl)prop-2-enoyl]phenoxy]acetic acid |
| SMILES | COc1cc(O)c(Br)cc1/C=C/C(=O)c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C18H15BrO6/c1-24-17-9-16(21)14(19)8-12(17)4-7-15(20)11-2-5-13(6-3-11)25-10-18(22)23/h2-9,21H,10H2,1H3,(H,22,23)/b7-4+ |
| InChIKey | AUBQSAVXPFETRD-QPJJXVBHSA-N |
| XLogP | 3.52 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|