C18H17NaO6 — CID 173442694
sodium;hydride;2-[4-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenoxy]acetic acid (PubChem CID 173442694) has the molecular formula C18H17NaO6 and a molecular weight of 352.32 g/mol. Its IUPAC name is sodium;hydride;2-[4-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenoxy]acetic acid.
| Compound Name | sodium;hydride;2-[4-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 173442694 |
| Molecular Formula | C18H17NaO6 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | sodium;hydride;2-[4-[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]phenoxy]acetic acid |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(OCC(=O)O)cc2)ccc1O.[H-].[Na+] |
| InChI | InChI=1S/C18H16O6.Na.H/c1-23-17-10-12(3-9-16(17)20)2-8-15(19)13-4-6-14(7-5-13)24-11-18(21)22;;/h2-10,20H,11H2,1H3,(H,21,22);;/q;+1;-1/b8-2+;; |
| InChIKey | WTMLZNFFKRYCJP-SZPWSVBHSA-N |
| XLogP | -0.12 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|