C18H16NaO6 — CID 70588806
CID 70588806 (PubChem CID 70588806) has the molecular formula C18H16NaO6 and a molecular weight of 351.31 g/mol.
| Compound Name | CID 70588806 |
|---|---|
| PubChem CID | 70588806 |
| Molecular Formula | C18H16NaO6 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | — |
| SMILES | COc1cc(/C=C/C(=O)c2ccc(OCC(=O)O)cc2)ccc1O.[Na] |
| InChI | InChI=1S/C18H16O6.Na/c1-23-17-10-12(3-9-16(17)20)2-8-15(19)13-4-6-14(7-5-13)24-11-18(21)22;/h2-10,20H,11H2,1H3,(H,21,22);/b8-2+; |
| InChIKey | DSJYBJQBVDEKDW-VOKCZWNHSA-N |
| XLogP | 2.38 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|