C30H33NO4 — CID 136896236
(E)-1-[4-[1-(2,4-dihydroxyphenyl)ethylideneamino]phenyl]-3-(4-heptoxyphenyl)prop-2-en-1-one (PubChem CID 136896236) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is (E)-1-[4-[1-(2,4-dihydroxyphenyl)ethylideneamino]phenyl]-3-(4-heptoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-[1-(2,4-dihydroxyphenyl)ethylideneamino]phenyl]-3-(4-heptoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 136896236 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | (E)-1-[4-[1-(2,4-dihydroxyphenyl)ethylideneamino]phenyl]-3-(4-heptoxyphenyl)prop-2-en-1-one |
| SMILES | CCCCCCCOc1ccc(/C=C/C(=O)c2ccc(/N=C(\C)c3ccc(O)cc3O)cc2)cc1 |
| InChI | InChI=1S/C30H33NO4/c1-3-4-5-6-7-20-35-27-16-8-23(9-17-27)10-19-29(33)24-11-13-25(14-12-24)31-22(2)28-18-15-26(32)21-30(28)34/h8-19,21,32,34H,3-7,20H2,1-2H3/b19-10+,31-22+ |
| InChIKey | LNFXFPOHFAUVFT-JZNQUVQNSA-N |
| XLogP | 7.48 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|