C29H22Cl2O4 — CID 163323175
3-(2,4-dichlorophenyl)-1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]prop-2-en-1-one (PubChem CID 163323175) has the molecular formula C29H22Cl2O4 and a molecular weight of 505.40 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]prop-2-en-1-one.
| Compound Name | 3-(2,4-dichlorophenyl)-1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 163323175 |
| Molecular Formula | C29H22Cl2O4 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 504.09 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-[2-hydroxy-4,6-bis(phenylmethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)c1c(O)cc(OCc2ccccc2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C29H22Cl2O4/c30-23-13-11-22(25(31)15-23)12-14-26(32)29-27(33)16-24(34-18-20-7-3-1-4-8-20)17-28(29)35-19-21-9-5-2-6-10-21/h1-17,33H,18-19H2 |
| InChIKey | ZKXJBARMYOZARN-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|