C22H20O7S2 — CID 66811185
5,7-dimethoxy-3-[(Z)-4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonylthiochromen-2-one (PubChem CID 66811185) has the molecular formula C22H20O7S2 and a molecular weight of 460.53 g/mol. Its IUPAC name is 5,7-dimethoxy-3-[(Z)-4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonylthiochromen-2-one.
| Compound Name | 5,7-dimethoxy-3-[(Z)-4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonylthiochromen-2-one |
|---|---|
| PubChem CID | 66811185 |
| Molecular Formula | C22H20O7S2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 5,7-dimethoxy-3-[(Z)-4-(4-methoxyphenyl)-2-oxobut-3-enyl]sulfonylthiochromen-2-one |
| SMILES | COc1ccc(/C=C\C(=O)CS(=O)(=O)c2cc3c(OC)cc(OC)cc3sc2=O)cc1 |
| InChI | InChI=1S/C22H20O7S2/c1-27-16-8-5-14(6-9-16)4-7-15(23)13-31(25,26)21-12-18-19(29-3)10-17(28-2)11-20(18)30-22(21)24/h4-12H,13H2,1-3H3/b7-4- |
| InChIKey | BLZGSDZGFNECHC-DAXSKMNVSA-N |
| XLogP | 3.34 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|